CymitQuimica logo

CAS 895261-88-8

:

methyl 3-(pyrrolidin-1-ylsulfonyl)thiophene-2-carboxylate

Description:
Methyl 3-(pyrrolidin-1-ylsulfonyl)thiophene-2-carboxylate is a chemical compound characterized by its unique structure, which includes a thiophene ring, a carboxylate group, and a pyrrolidine moiety linked through a sulfonyl group. This compound typically exhibits properties associated with both the thiophene and pyrrolidine functionalities, such as potential aromaticity and the ability to participate in various chemical reactions. The presence of the sulfonyl group enhances its reactivity and solubility in polar solvents. Methyl 3-(pyrrolidin-1-ylsulfonyl)thiophene-2-carboxylate may also demonstrate biological activity, making it of interest in medicinal chemistry and drug development. Its molecular interactions can be influenced by the steric and electronic effects of the substituents, which may affect its pharmacokinetic properties. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks depending on its specific chemical behavior and potential toxicity.
Formula:C10H13NO4S2
InChI:InChI=1/C10H13NO4S2/c1-15-10(12)9-8(4-7-16-9)17(13,14)11-5-2-3-6-11/h4,7H,2-3,5-6H2,1H3
SMILES:COC(=O)c1c(ccs1)S(=O)(=O)N1CCCC1
Synonyms:
  • 2-Thiophenecarboxylic Acid, 3-(1-Pyrrolidinylsulfonyl)-, Methyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.