CAS 89530-34-7
:1-phenyl-3-(trimethylsilyl)prop-2-yn-1-ol
Description:
1-Phenyl-3-(trimethylsilyl)prop-2-yn-1-ol is an organic compound characterized by its unique structure, which includes a phenyl group, a propyne moiety, and a trimethylsilyl (TMS) group. This compound features a hydroxyl (-OH) functional group, which contributes to its reactivity and solubility in polar solvents. The presence of the TMS group enhances its stability and makes it less polar, which can influence its behavior in various chemical reactions, particularly in nucleophilic substitutions and eliminations. The alkyne functionality in the structure allows for potential participation in cycloadditions and other reactions typical of unsaturated compounds. Additionally, the phenyl group can provide aromatic stabilization and influence the electronic properties of the molecule. This compound is of interest in synthetic organic chemistry, particularly in the development of new materials and pharmaceuticals, due to its versatile reactivity and functional groups. Its CAS number, 89530-34-7, is a unique identifier that facilitates its identification in chemical databases and literature.
Formula:C12H16OSi
InChI:InChI=1/C12H16OSi/c1-14(2,3)10-9-12(13)11-7-5-4-6-8-11/h4-8,12-13H,1-3H3
SMILES:C[Si](C)(C)C#CC(c1ccccc1)O
Synonyms:- Benzenemethanol, alpha-[2-(trimethylsilyl)ethynyl]-
- 1-Phenyl-3-(trimethylsilyl)prop-2-yn-1-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Phenyl-3-trimethylsilyl-2-propyn-1-ol, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C12H16OSiPurity:97%Color and Shape:LiquidMolecular weight:204.34Benzenemethanol, a-[2-(trimethylsilyl)ethynyl]-
CAS:Formula:C12H16OSiPurity:97%Molecular weight:204.34031-Phenyl-3-(trimethylsilyl)prop-2-yn-1-ol
CAS:1-Phenyl-3-(trimethylsilyl)prop-2-yn-1-olPurity:97%Molecular weight:204.35g/mol


