
CAS 89531-67-9
:4-Amino-2,2-dimethyl-4-oxobutanoic acid
Description:
4-Amino-2,2-dimethyl-4-oxobutanoic acid, with the CAS number 89531-67-9, is an organic compound characterized by the presence of an amino group, a ketone, and a carboxylic acid functional group. This compound features a branched structure due to the two methyl groups attached to the central carbon, contributing to its unique properties. It is typically a white to off-white solid and is soluble in polar solvents, reflecting its polar functional groups. The presence of the amino group suggests potential for forming hydrogen bonds, which can influence its reactivity and interactions in biological systems. This compound may be of interest in various fields, including pharmaceuticals and biochemistry, due to its potential role as an intermediate in the synthesis of more complex molecules or as a building block in drug development. Its stability and reactivity can be influenced by pH and temperature, making it important to consider these factors in practical applications.
Formula:C6H11NO3
InChI:InChI=1S/C6H11NO3/c1-6(2,5(9)10)3-4(7)8/h3H2,1-2H3,(H2,7,8)(H,9,10)
InChI key:InChIKey=IBPSGJDBOYFNEM-UHFFFAOYSA-N
SMILES:C(CC(N)=O)(C(O)=O)(C)C
Synonyms:- Butanoic acid, 4-amino-2,2-dimethyl-4-oxo-
- NSC 97172
- Succinamic acid, 2,2-dimethyl-
- 3-Carbamoyl-2,2-dimethylpropanoic acid
- 4-Amino-2,2-dimethyl-4-oxobutanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
