CAS 89531-98-6
:5-(2-methylpropoxy)-1,3,4-thiadiazol-2-amine
Description:
5-(2-Methylpropoxy)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structural features, including a thiadiazole ring and an amine functional group. The presence of the thiadiazole moiety contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The 2-methylpropoxy group enhances its solubility and may influence its interaction with biological targets. This compound is typically synthesized through specific organic reactions that involve the formation of the thiadiazole ring and subsequent substitution reactions to introduce the alkoxy group. Its applications may span across fields such as medicinal chemistry, where it could serve as a lead compound for drug development, particularly in areas targeting infectious diseases or cancer. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, 5-(2-methylpropoxy)-1,3,4-thiadiazol-2-amine represents a compound of interest for further research and development in various chemical and pharmaceutical applications.
Formula:C6H11N3OS
InChI:InChI=1/C6H11N3OS/c1-4(2)3-10-6-9-8-5(7)11-6/h4H,3H2,1-2H3,(H2,7,8)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
