CymitQuimica logo

CAS 89532-09-2

:

Levulinic acid semicarbazone

Description:
Levulinic acid semicarbazone is a chemical compound derived from levulinic acid, which is a five-carbon ketone acid. It is characterized by the presence of a semicarbazone functional group, formed by the reaction of levulinic acid with semicarbazide. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar solvents such as water and ethanol, which is indicative of its polar nature due to the presence of functional groups capable of hydrogen bonding. Levulinic acid semicarbazone is of interest in various fields, including organic synthesis and pharmaceuticals, due to its potential biological activities and applications. The compound may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities can vary based on structural modifications and the presence of substituents. As with many organic compounds, proper handling and safety precautions should be observed, as it may pose health risks if ingested or improperly managed.
Formula:C6H11N3O3
InChI:InChI=1/C6H11N3O3/c1-4(2-3-5(10)11)8-9-6(7)12/h2-3H2,1H3,(H,10,11)(H3,7,9,12)
SMILES:CC(=NNC(=N)O)CCC(=O)O
Synonyms:
  • 4-(2-Carbamoylhydrazinylidene)Pentanoic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.