CymitQuimica logo

CAS 89532-49-0

:

3-Methyl-2-oxo-3-pyrrolidinecarbonitrile

Description:
3-Methyl-2-oxo-3-pyrrolidinecarbonitrile, with the CAS number 89532-49-0, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This compound features a carbonitrile functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of a ketone group (2-oxo) indicates that it has a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions. The methyl group at the 3-position adds to the compound's steric and electronic properties, influencing its behavior in chemical reactions. Typically, compounds like this may exhibit moderate to high polarity due to the presence of both the carbonitrile and carbonyl groups, affecting their solubility in polar solvents. Additionally, the compound may have potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the structural motifs that are often associated with biological activity. However, specific safety and handling information should be consulted from material safety data sheets (MSDS) or relevant literature.
Formula:C6H8N2O
InChI:InChI=1S/C6H8N2O/c1-6(4-7)2-3-8-5(6)9/h2-3H2,1H3,(H,8,9)
InChI key:InChIKey=MXSTWOYDCTXDIV-UHFFFAOYSA-N
SMILES:C(#N)C1(C)C(=O)NCC1
Synonyms:
  • 3-Pyrrolidinecarbonitrile, 3-methyl-2-oxo-
  • 3-Methyl-2-oxo-3-pyrrolidinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.