CAS 89532-73-0

3-(1H-pyrazol-1-yl)propanoic acid

Description:

3-(1H-pyrazol-1-yl)propanoic acid is an organic compound characterized by the presence of a pyrazole ring and a propanoic acid functional group. It features a three-carbon chain (propanoic acid) attached to a pyrazole moiety, which contributes to its unique chemical properties. The compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid group. Its molecular structure allows for potential interactions through hydrogen bonding, making it of interest in various chemical and biological applications. The pyrazole ring can participate in coordination with metal ions, which may enhance its utility in medicinal chemistry and material science. Additionally, the compound may exhibit biological activity, making it a candidate for further research in pharmacology. As with many organic acids, it may display acidic properties, influencing its reactivity and interactions in different environments. Overall, 3-(1H-pyrazol-1-yl)propanoic acid is a versatile compound with potential applications in various fields of research.

Formula: C₆H₈N₂O₂

InChI: InChI=1/C6H8N2O2/c9-6(10)2-5-8-4-1-3-7-8/h1,3-4H,2,5H2,(H,9,10)

SMILES: c1cnn(c1)CCC(=O)O

Synonyms:

• 1H-Pyrazole-1-propanoic acid
• 3-(1H-Pyrazol-1-yl)propanoic acid

3-(1H-Pyrazol-1-yl)propanoic acid

CAS: 89532-73-0

Formula: C₆H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 140.1399

Ref: IN-DA003HZP

3-(1H-Pyrazol-1-yl)propanoic acid

CAS: 89532-73-0

3-(1H-Pyrazol-1-yl)propanoic acid

Purity: 99%

Molecular weight: 140.14g/mol

Ref: 54-OR953062

3-Pyrazol-1-yl-propionic acid

CAS: 89532-73-0

Formula: C₆H₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 140.142

Ref: 10-F028328