
CAS 89532-84-3
:4,5-Dihydro-2-methyl-5-oxo-1H-pyrrole-3-carboxamide
Description:
4,5-Dihydro-2-methyl-5-oxo-1H-pyrrole-3-carboxamide, with the CAS number 89532-84-3, is a chemical compound characterized by its pyrrole structure, which is a five-membered aromatic ring containing nitrogen. This compound features a carboxamide functional group, contributing to its potential reactivity and solubility in polar solvents. The presence of a keto group (5-oxo) and a methyl group at the 2-position enhances its chemical properties, making it a subject of interest in various synthetic applications. Typically, compounds of this nature may exhibit biological activity, which could be explored in pharmaceutical research. Its molecular structure suggests potential interactions with biological systems, possibly influencing enzyme activity or serving as a precursor in organic synthesis. The compound's stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature, making it essential to consider these factors in practical applications. Overall, 4,5-Dihydro-2-methyl-5-oxo-1H-pyrrole-3-carboxamide represents a versatile building block in organic chemistry and medicinal chemistry.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c1-3-4(6(7)10)2-5(9)8-3/h2H2,1H3,(H2,7,10)(H,8,9)
InChI key:InChIKey=QHFCWSUWROWPFQ-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1CC(=O)NC1C
Synonyms:- 2-Hydroxy-5-methyl-3H-pyrrole-4-carboxamide
- 1H-Pyrrole-3-carboxamide, 4,5-dihydro-2-methyl-5-oxo-
- 4,5-Dihydro-2-methyl-5-oxo-1H-pyrrole-3-carboxamide
- 2-Pyrroline-3-carboxamide, 2-methyl-5-oxo-
- 2-Methyl-5-oxo-4,5-dihydro-1H-pyrrole-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.