CymitQuimica logo

CAS 89533-03-9

:

[3,3′-Bioxazolidine]-2,2′-dione

Description:
[3,3′-Bioxazolidine]-2,2′-dione, with the CAS number 89533-03-9, is a heterocyclic organic compound characterized by its unique bicyclic structure that includes two oxazolidine rings. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups within its molecular framework. The oxazolidine rings contribute to its potential as a chiral building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its reactivity is influenced by the presence of the carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, the stereochemistry of the compound can play a significant role in its biological activity, making it of interest in medicinal chemistry. Overall, [3,3′-Bioxazolidine]-2,2′-dione is a versatile compound with potential applications in synthetic organic chemistry and drug development.
Formula:C6H8N2O4
InChI:InChI=1S/C6H8N2O4/c9-5-7(1-3-11-5)8-2-4-12-6(8)10/h1-4H2
InChI key:InChIKey=HTTOAZGYFLWWHP-UHFFFAOYSA-N
SMILES:O=C1N(CCO1)N2C(=O)OCC2
Synonyms:
  • NSC 38255
  • [3,3′-Bioxazolidine]-2,2′-dione
  • 3,3'-bi-1,3-Oxazolidine-2,2'-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.