CAS 89533-03-9

[3,3′-Bioxazolidine]-2,2′-dione

Description:

[3,3′-Bioxazolidine]-2,2′-dione, with the CAS number 89533-03-9, is a heterocyclic organic compound characterized by its unique bicyclic structure that includes two oxazolidine rings. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups within its molecular framework. The oxazolidine rings contribute to its potential as a chiral building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its reactivity is influenced by the presence of the carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, the stereochemistry of the compound can play a significant role in its biological activity, making it of interest in medicinal chemistry. Overall, [3,3′-Bioxazolidine]-2,2′-dione is a versatile compound with potential applications in synthetic organic chemistry and drug development.

Formula: C₆H₈N₂O₄

InChI: InChI=1S/C6H8N2O4/c9-5-7(1-3-11-5)8-2-4-12-6(8)10/h1-4H2

InChI key: InChIKey=HTTOAZGYFLWWHP-UHFFFAOYSA-N

SMILES: O=C1N(CCO1)N2C(=O)OCC2

Synonyms:

• NSC 38255
• [3,3′-Bioxazolidine]-2,2′-dione
• 3,3'-bi-1,3-Oxazolidine-2,2'-dione

[3,3'-Bioxazolidine]-2,2'-dione

CAS: 89533-03-9

Formula: C₆H₈N₂O₄

Molecular weight: 172.1387

Ref: IN-DA0040KD