CymitQuimica logo

CAS 89533-16-4

:

3-(2-thioxo-1,3-thiazolidin-3-yl)propanenitrile

Description:
3-(2-thioxo-1,3-thiazolidin-3-yl)propanenitrile, identified by its CAS number 89533-16-4, is a chemical compound that features a thiazolidine ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound is characterized by the presence of a thioxo group, contributing to its reactivity and potential biological activity. The propanenitrile moiety indicates the presence of a cyano group (-C≡N), which can enhance the compound's polarity and solubility in polar solvents. The thiazolidine structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's unique functional groups suggest potential applications in organic synthesis and as intermediates in the development of pharmaceuticals. Its stability, reactivity, and interaction with biological systems would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reactants. Overall, this compound exemplifies the diverse chemistry associated with thiazolidine derivatives.
Formula:C6H8N2S2
InChI:InChI=1/C6H8N2S2/c7-2-1-3-8-4-5-10-6(8)9/h1,3-5H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.