CymitQuimica logo

CAS 89534-37-2

:

pentitol, 1,5-anhydro-2,4-dideoxy-2-methyl-

Description:
Pentitol, 1,5-anhydro-2,4-dideoxy-2-methyl- is a chemical compound characterized by its unique structure, which includes a pentitol backbone with specific modifications. This compound features an anhydro form, indicating the absence of water molecules that would typically be present in a hydrated state. The presence of dideoxy and methyl groups suggests that it has undergone specific substitutions that alter its reactivity and properties compared to standard pentitols. Generally, compounds of this nature may exhibit solubility in polar solvents, and their reactivity can be influenced by the functional groups present. Additionally, the structural modifications can impact biological activity, making such compounds of interest in various fields, including medicinal chemistry and biochemistry. The CAS number 89534-37-2 serves as a unique identifier for this substance, facilitating its recognition in scientific literature and databases. Overall, pentitol, 1,5-anhydro-2,4-dideoxy-2-methyl- represents a specialized compound with potential applications in research and industry.
Formula:C6H12O2
InChI:InChI=1/C6H12O2/c1-5-4-8-3-2-6(5)7/h5-7H,2-4H2,1H3
SMILES:CC1COCCC1O
Synonyms:
  • 1,5-Anhydro-2,4-dideoxy-2-methylpentitol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.