CAS 89534-40-7

3-(ethylsulfanyl)butanoic acid

Description:

3-(Ethylsulfanyl)butanoic acid, with the CAS number 89534-40-7, is an organic compound characterized by the presence of a butanoic acid backbone substituted with an ethylsulfanyl group at the third carbon position. This compound features a carboxylic acid functional group (-COOH), which imparts acidic properties, making it soluble in water and capable of participating in various chemical reactions, such as esterification and amidation. The ethylsulfanyl group contributes to the compound's unique reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of sulfur in the structure can influence the compound's polarity and overall stability. Additionally, 3-(ethylsulfanyl)butanoic acid may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological systems, which could lead to various therapeutic applications. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₆H₁₂O₂S

InChI: InChI=1/C6H12O2S/c1-3-9-5(2)4-6(7)8/h5H,3-4H2,1-2H3,(H,7,8)

SMILES: CCSC(C)CC(=O)O

3-(Ethylthio)-butanoicAcid

CAS: 89534-40-7

Formula: C₆H₁₂O₂S

Purity: 97%

Color and Shape: Liquid

Molecular weight: 148.2233

Ref: IN-DA01E5OW

3-(Ethylthio)-butanoicAcid

CAS: 89534-40-7

3-(Ethylthio)-butanoicAcid

Purity: 97%

Molecular weight: 148.22g/mol

Ref: 54-OR1042537

3-(Ethylthio)butanoic acid

CAS: 89534-40-7

Purity: 97%

Molecular weight: 148.2200012

Ref: 10-F692351

3-(Ethylthio)-butanoic Acid

Controlled Product

CAS: 89534-40-7

Formula: C₆H₁₂O₂S

Color and Shape: Neat

Molecular weight: 148.223

Ref: TR-E926770