
CAS 89534-74-7
:2-Methyl-1-(methylthio)-2-butene
Description:
2-Methyl-1-(methylthio)-2-butene is an organic compound characterized by its structure, which includes a double bond and a methylthio group. It is classified as an alkene due to the presence of a carbon-carbon double bond, specifically at the first position of the butene chain. The methylthio group, which consists of a sulfur atom bonded to a methyl group, contributes to the compound's reactivity and potential applications in organic synthesis. This compound is typically a colorless liquid with a distinctive odor, and it is soluble in organic solvents. Its chemical properties include the ability to undergo typical alkene reactions, such as electrophilic addition and polymerization. The presence of the sulfur atom may also impart unique characteristics, such as increased nucleophilicity. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 2-Methyl-1-(methylthio)-2-butene is of interest in various chemical research and industrial applications.
Formula:C6H12S
InChI:InChI=1S/C6H12S/c1-4-6(2)5-7-3/h4H,5H2,1-3H3
InChI key:InChIKey=PBWZEERIWACABP-UHFFFAOYSA-N
SMILES:C(CSC)(=CC)C
Synonyms:- 2-Methyl-1-(methylthio)-2-butene
- 2-Butene, 2-methyl-1-(methylthio)-
- Sulfide, methyl 2-methyl-2-butenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
