CAS 89544-84-3

1-Bromocyclopropanecarboxylic acid

Description:

1-Bromocyclopropanecarboxylic acid is an organic compound characterized by the presence of a bromine atom and a carboxylic acid functional group attached to a cyclopropane ring. Its molecular structure features a three-membered cyclopropane ring, which contributes to its unique reactivity and strain. The bromine substituent enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The carboxylic acid group (-COOH) imparts acidic characteristics, allowing it to participate in acid-base reactions and serve as a precursor for further chemical transformations. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents and exhibits moderate stability under standard conditions. Due to its functional groups, 1-bromocyclopropanecarboxylic acid can be utilized in synthetic organic chemistry, particularly in the synthesis of more complex molecules and as an intermediate in pharmaceutical applications. Safety precautions should be observed when handling this compound, as it may pose health hazards typical of halogenated organic substances.

Formula: C₄H₅BrO₂

InChI: InChI=1S/C4H5BrO2/c5-4(1-2-4)3(6)7/h1-2H2,(H,6,7)

InChI key: InChIKey=LGHSAVSEBATWBX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(Br)CC1

Synonyms:

• 1-Bromocyclopropane-1-carboxylic acid
• 1-Bromocyclopropanecarboxylic acid
• Cyclopropanecarboxylic acid, 1-bromo-

1-Bromocyclopropanecarboxylic acid

CAS: 89544-84-3

Formula: C₄H₅BrO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 164.9853

Ref: IN-DA00874M

1-Bromocyclopropanecarboxylic acid

CAS: 89544-84-3

1-Bromocyclopropanecarboxylic acid

Purity: 97%

Molecular weight: 164.986g/mol

Ref: 54-OR73253

1-Bromocyclopropanecarboxylic acid

CAS: 89544-84-3

Formula: C₄H₅BrO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 164.986

Ref: 10-F043233