CymitQuimica logo

CAS 89550-93-6

:

4-Hydroxy-8-thioxocyclohept[c][1,2]oxathiol-3(8H)-one

Description:
4-Hydroxy-8-thioxocyclohept[c][1,2]oxathiol-3(8H)-one, with the CAS number 89550-93-6, is a heterocyclic compound characterized by its unique ring structure that incorporates both sulfur and oxygen atoms. This compound features a cycloheptane framework, which is a seven-membered ring, and includes a hydroxyl group (-OH) and a thioxo group (C=S) that contribute to its reactivity and potential biological activity. The presence of these functional groups suggests that it may exhibit properties such as antioxidant activity or the ability to participate in nucleophilic reactions. Additionally, the compound's structural features may influence its solubility, stability, and interaction with other molecules, making it of interest in various fields, including medicinal chemistry and materials science. Its specific applications and biological effects would depend on further research and characterization, including studies on its synthesis, reactivity, and potential therapeutic uses.
Formula:C8H4O3S2
InChI:InChI=1S/C8H4O3S2/c9-4-2-1-3-5(12)7-6(4)8(10)11-13-7/h1-3,9H
InChI key:InChIKey=DQGOJKVIMNNGAH-UHFFFAOYSA-N
SMILES:O=C1C2=C(SO1)C(=S)C=CC=C2O
Synonyms:
  • Thiotropocin
  • Cyclohept[c][1,2]oxathiol-3(8H)-one, 4-hydroxy-8-thioxo-
  • 4-Hydroxy-8-thioxocyclohept[c][1,2]oxathiol-3(8H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.