
CAS 895521-61-6
:1-(2′-Chloro-1,2,3,4-tetrahydro[2,3′-biquinolin]-4-yl)-2-pyrrolidinone
Description:
1-(2′-Chloro-1,2,3,4-tetrahydro[2,3′-biquinolin]-4-yl)-2-pyrrolidinone, with the CAS number 895521-61-6, is a chemical compound that features a complex bicyclic structure. It contains a chloro-substituted biquinoline moiety, which contributes to its potential biological activity. The presence of the pyrrolidinone ring indicates that it may exhibit properties typical of lactams, such as being a potential nucleophile or electrophile in chemical reactions. This compound may be of interest in medicinal chemistry due to its structural features, which could influence its interaction with biological targets. Additionally, the chloro group may enhance its reactivity or alter its pharmacokinetic properties. As with many compounds in this class, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Research into its specific applications, biological activity, and synthesis would provide further insights into its utility in various fields, including pharmaceuticals and materials science.
Formula:C22H20ClN3O
InChI:InChI=1S/C22H20ClN3O/c23-22-16(12-14-6-1-3-8-17(14)25-22)19-13-20(26-11-5-10-21(26)27)15-7-2-4-9-18(15)24-19/h1-4,6-9,12,19-20,24H,5,10-11,13H2
InChI key:InChIKey=OWYFVLITKZRFPH-UHFFFAOYSA-N
SMILES:O=C1N(C2C=3C(NC(C2)C4=CC5=C(N=C4Cl)C=CC=C5)=CC=CC3)CCC1
Synonyms:- 2-Pyrrolidinone, 1-(2′-chloro-1,2,3,4-tetrahydro[2,3′-biquinolin]-4-yl)-
- 1-(2′-Chloro-1,2,3,4-tetrahydro[2,3′-biquinolin]-4-yl)-2-pyrrolidinone
- 1-[2-(2-Chloroquinolin-3-yl)-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.