CymitQuimica logo

CAS 89564-53-4

:

6,11-dioxo-1,2,3,4,6,11-hexahydrotetracene-1,5,12-triyl triacetate

Description:
6,11-Dioxo-1,2,3,4,6,11-hexahydrotetracene-1,5,12-triyl triacetate, with the CAS number 89564-53-4, is a synthetic organic compound characterized by its complex polycyclic structure, which includes multiple fused aromatic rings. This compound features dioxo functional groups and triacetate moieties, contributing to its chemical reactivity and potential applications in organic electronics and materials science. The presence of the hexahydrotetracene framework suggests that it may exhibit interesting electronic properties, such as semiconducting behavior or light absorption characteristics, making it a candidate for use in organic photovoltaic devices or as a dye. Its synthesis typically involves multi-step organic reactions, and its stability and solubility can vary based on the substituents present. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact. Overall, this compound represents a fascinating area of study within organic chemistry, particularly in the context of developing new materials for advanced technological applications.
Formula:C24H20O8
InChI:InChI=1/C24H20O8/c1-11(25)30-17-10-6-9-16-18(17)24(32-13(3)27)20-19(23(16)31-12(2)26)21(28)14-7-4-5-8-15(14)22(20)29/h4-5,7-8,17H,6,9-10H2,1-3H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.