CAS 89565-25-3
:N-[4-(Aminosulfonyl)phenyl]-4-pyridinecarboxamide
Description:
N-[4-(Aminosulfonyl)phenyl]-4-pyridinecarboxamide, with the CAS number 89565-25-3, is a chemical compound characterized by its structural features that include a pyridine ring and a sulfonamide group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the aminosulfonyl group suggests it may have applications in medicinal chemistry, possibly as an inhibitor or modulator in various biochemical pathways. Its solubility and stability can vary depending on the pH and solvent conditions, which are important for its practical applications. Additionally, the compound may exhibit specific interactions with biological targets due to its functional groups, making it of interest in drug development and research. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards associated with its use. Overall, N-[4-(Aminosulfonyl)phenyl]-4-pyridinecarboxamide represents a compound with significant potential in various scientific fields.
Formula:C12H11N3O3S
InChI:InChI=1S/C12H11N3O3S/c13-19(17,18)11-3-1-10(2-4-11)15-12(16)9-5-7-14-8-6-9/h1-8H,(H,15,16)(H2,13,17,18)
InChI key:InChIKey=DGZUOZYUUABWGX-UHFFFAOYSA-N
SMILES:N(C(=O)C=1C=CN=CC1)C2=CC=C(S(N)(=O)=O)C=C2
Synonyms:- N-[4-(Aminosulfonyl)phenyl]-4-pyridinecarboxamide
- 4-Pyridinecarboxamide, N-[4-(aminosulfonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
