CAS 895664-33-2
:3-chloro-N-(4-fluoro-2-methylphenyl)propanamide
Description:
3-Chloro-N-(4-fluoro-2-methylphenyl)propanamide is a chemical compound characterized by its amide functional group, which is indicative of its potential applications in pharmaceuticals and agrochemicals. The presence of a chloro group and a fluoro-substituted aromatic ring contributes to its unique reactivity and biological activity. This compound typically exhibits moderate to high solubility in organic solvents, while its solubility in water may vary depending on the specific conditions. The molecular structure suggests that it may engage in hydrogen bonding due to the amide group, influencing its physical properties such as melting and boiling points. Additionally, the presence of halogen atoms can enhance lipophilicity, affecting its distribution in biological systems. As with many halogenated compounds, it is essential to consider its environmental impact and potential toxicity. Overall, 3-chloro-N-(4-fluoro-2-methylphenyl)propanamide represents a class of compounds that may have significant utility in various chemical and biological applications.
Formula:C10H11ClFNO
InChI:InChI=1/C10H11ClFNO/c1-7-6-8(12)2-3-9(7)13-10(14)4-5-11/h2-3,6H,4-5H2,1H3,(H,13,14)
SMILES:Cc1cc(ccc1NC(=O)CCCl)F
Synonyms:- propanamide, 3-chloro-N-(4-fluoro-2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
