CAS 89567-03-3

2-(Chloromethyl)-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4(1H)-one

Description:

2-(Chloromethyl)-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4(1H)-one is a heterocyclic organic compound characterized by its complex structure, which includes a benzothieno moiety fused with a pyrimidinone ring. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of the tetrahydro configuration indicates that the compound has a saturated ring system, contributing to its stability and solubility in various solvents. It is typically used in medicinal chemistry and drug development due to its potential biological activity, particularly in the context of targeting specific enzymes or receptors. The compound's unique structural features may impart specific pharmacological properties, making it of interest in the synthesis of novel therapeutic agents. As with many heterocycles, it may exhibit diverse chemical reactivity, including nucleophilic substitution and electrophilic aromatic substitution, which can be exploited in synthetic applications. Safety and handling precautions should be observed due to the presence of the chloromethyl group, which can be reactive and potentially hazardous.

Formula: C₁₁H₁₁ClN₂OS

InChI: InChI=1S/C11H11ClN2OS/c12-5-8-13-10(15)9-6-3-1-2-4-7(6)16-11(9)14-8/h1-5H2,(H,13,14,15)

InChI key: InChIKey=GDHMBNWVLWMONW-UHFFFAOYSA-N

SMILES: O=C1C=2C3=C(SC2NC(CCl)=N1)CCCC3

Synonyms:

• 2-(Chloromethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one
• 2-(Chloromethyl)-5,6,7,8-tetrahydro-[1]benzothieno[2,3-d]pyrimidin-4(1H)-one
• 2-(chloromethyl)-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4(3H)-one
• Lm-1554
• Ls-41028
• [1]Benzothieno[2,3-d]pyrimidin-4(1H)-one, 2-(chloromethyl)-5,6,7,8-tetrahydro-

5-(Chloromethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2(7),5-trien-3-one

CAS: 89567-03-3

5-(Chloromethyl)-8-thia-4,6-diazatricyclo[7.4.0.0,2,7]trideca-1(9),2(7),5-trien-3-one is a molecule with the potential to outperform current devices and techniques for environmental monitoring. It has been shown to have optimal performance when used in a variety of different modules and techniques for research purposes. This compound is also being researched as an option for optimizing frequency and transferring data between modules. These optimizations will be made using parameters that are optimized to optimize the device's performance while minimizing power consumption.

Formula: C₁₁H₁₁ClN₂OS

Purity: Min. 95%

Molecular weight: 254.74 g/mol

Ref: 3D-PDA56703