CAS 89567-06-6
:Ethyl 2-(chloromethyl)-1,4-dihydro-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate
Description:
Ethyl 2-(chloromethyl)-1,4-dihydro-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate, with the CAS number 89567-06-6, is a heterocyclic compound characterized by its complex structure that includes a thieno[2,3-d]pyrimidine core. This compound features a carboxylate ester functional group, which contributes to its reactivity and solubility properties. The presence of a chloromethyl group enhances its potential for further chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, the methyl and ethyl substituents influence its physical properties, such as boiling and melting points, as well as its solubility in various solvents. The compound may exhibit biological activity, which is common among thieno[2,3-d]pyrimidine derivatives, potentially making it of interest in pharmaceutical research. Its synthesis typically involves multi-step reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Overall, this compound represents a significant class of organic molecules with potential applications in medicinal chemistry.
Formula:C11H11ClN2O3S
InChI:InChI=1/C11H11ClN2O3S/c1-3-17-11(16)8-5(2)7-9(15)13-6(4-12)14-10(7)18-8/h3-4H2,1-2H3,(H,13,14,15)
InChI key:InChIKey=NDYRHNGDLDUAFF-UHFFFAOYSA-N
SMILES:CC=1C2=C(SC1C(OCC)=O)NC(CCl)=NC2=O
Synonyms:- 2-Chloromethyl-5-methyl-4-oxo-3,4-dihydro-thieno[2,3-d]pyrimidine-6-carboxylic acid ethyl ester
- Ethyl 2-(chloromethyl)-1,4-dihydro-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate
- Thieno[2,3-D]Pyrimidine-6-Carboxylic Acid, 2-(Chloromethyl)-3,4-Dihydro-5-Methyl-4-Oxo-, Ethyl Ester
- Thieno[2,3-d]pyrimidine-6-carboxylic acid, 2-(chloromethyl)-1,4-dihydro-5-methyl-4-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 2-(chloromethyl)-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxylate
CAS:Formula:C11H11ClN2O3SMolecular weight:286.7346
