CymitQuimica logo

CAS 89567-08-8

:

2-(Phenylmethyl)thieno[2,3-d]pyrimidin-4(1H)-one

Description:
2-(Phenylmethyl)thieno[2,3-d]pyrimidin-4(1H)-one, with the CAS number 89567-08-8, is a heterocyclic compound that features a thieno-pyrimidine core structure. This compound is characterized by the presence of a thieno ring fused to a pyrimidine ring, which contributes to its unique chemical properties. The phenylmethyl group attached to the thieno moiety enhances its lipophilicity and may influence its biological activity. Typically, such compounds exhibit a range of pharmacological properties, making them of interest in medicinal chemistry. The presence of the carbonyl group in the pyrimidinone structure can participate in hydrogen bonding, affecting solubility and reactivity. Additionally, the compound may exhibit potential as a scaffold for drug development, particularly in targeting specific biological pathways. Its synthesis and characterization often involve standard organic chemistry techniques, including condensation reactions and purification methods. Overall, 2-(Phenylmethyl)thieno[2,3-d]pyrimidin-4(1H)-one represents a valuable compound for research in both synthetic and medicinal chemistry.
Formula:C13H10N2OS
InChI:InChI=1S/C13H10N2OS/c16-12-10-6-7-17-13(10)15-11(14-12)8-9-4-2-1-3-5-9/h1-7H,8H2,(H,14,15,16)
InChI key:InChIKey=IPBXJINVHOWWCR-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(CC3=CC=CC=C3)=N1)SC=C2
Synonyms:
  • 2-(Phenylmethyl)thieno[2,3-d]pyrimidin-4(1H)-one
  • Thieno[2,3-d]pyrimidin-4(1H)-one, 2-(phenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.