CymitQuimica logo

CAS 89569-62-0

:

N-(2-Imino-1-pyrrolidinyl)benzamide

Description:
N-(2-Imino-1-pyrrolidinyl)benzamide, with the CAS number 89569-62-0, is a chemical compound that features a benzamide structure modified by the presence of a pyrrolidine ring. This compound is characterized by its amide functional group, which contributes to its potential solubility in polar solvents and its ability to participate in hydrogen bonding. The presence of the imino group in the pyrrolidine ring may impart unique reactivity and stability characteristics, influencing its behavior in various chemical environments. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, N-(2-Imino-1-pyrrolidinyl)benzamide represents a class of compounds with diverse applications in chemistry and pharmacology.
Formula:C11H13N3O
InChI:InChI=1S/C11H13N3O/c12-10-7-4-8-14(10)13-11(15)9-5-2-1-3-6-9/h1-3,5-6,12H,4,7-8H2,(H,13,15)
InChI key:InChIKey=WWHBOIMBXDYRGL-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CC=C1)N2C(=N)CCC2
Synonyms:
  • 1-Benzoylamino-2-imino-2,3,4,5-tetrahydropyrrole
  • Benzamide, N-(2-imino-1-pyrrolidinyl)-
  • N-(2-Imino-1-pyrrolidinyl)benzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.