CAS 89571-97-1

6-[(2-Ethoxyphenyl)amino]-5H-benzo[a]phenothiazin-5-one

Description:

6-[(2-Ethoxyphenyl)amino]-5H-benzo[a]phenothiazin-5-one, with the CAS number 89571-97-1, is a chemical compound that belongs to the class of phenothiazine derivatives. This substance features a complex structure characterized by a phenothiazine core, which is a tricyclic compound containing sulfur and nitrogen atoms. The presence of the ethoxyphenylamino group enhances its solubility and may influence its biological activity. Typically, compounds of this nature exhibit a range of pharmacological properties, including potential antipsychotic, antihistaminic, or antimicrobial effects, due to their ability to interact with various biological targets. The compound's molecular structure contributes to its stability and reactivity, making it of interest in medicinal chemistry and drug development. Additionally, its unique functional groups may allow for further modifications to optimize its therapeutic efficacy or reduce side effects. As with many organic compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles can vary significantly.

Formula: C₂₄H₁₈N₂O₂S

InChI: InChI=1S/C24H18N2O2S/c1-2-28-19-13-7-5-11-17(19)25-22-23(27)16-10-4-3-9-15(16)21-24(22)29-20-14-8-6-12-18(20)26-21/h3-14,25H,2H2,1H3

InChI key: InChIKey=SMCRPXPBNZCYEJ-UHFFFAOYSA-N

SMILES: N(C1=C2C(C=3C(C1=O)=CC=CC3)=NC=4C(S2)=CC=CC4)C5=C(OCC)C=CC=C5

Synonyms:

• 5H-Benzo[a]phenothiazin-5-one, 6-[(2-ethoxyphenyl)amino]-
• 6-[(2-Ethoxyphenyl)amino]-5H-benzo[a]phenothiazin-5-one

5H-Benzo[a]phenothiazin-5-one, 6-[(2-ethoxyphenyl)amino]-

CAS: 89571-97-1

Formula: C₂₄H₁₈N₂O₂S

Molecular weight: 398.4769

Ref: IN-DA003Z9D