CAS 89580-96-1
:bis(2-chloroethyl) hydrazine-1,2-dicarboxylate
Description:
Bis(2-chloroethyl) hydrazine-1,2-dicarboxylate is a chemical compound characterized by its hydrazine backbone and two chloroethyl groups, which contribute to its reactivity and potential biological activity. This compound features two carboxylate functional groups, which can enhance its solubility in polar solvents and influence its interaction with biological systems. The presence of chlorine atoms in the structure may impart additional properties, such as increased lipophilicity and potential for electrophilic reactions. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of antitumor agents or as intermediates in organic synthesis. However, due to the presence of reactive functional groups, safety precautions are essential when handling this substance, as it may pose health risks. Its stability, reactivity, and specific applications would depend on the conditions under which it is used, including temperature, pH, and the presence of other reagents.
Formula:C6H10Cl2N2O4
InChI:InChI=1/C6H10Cl2N2O4/c7-1-3-13-5(11)9-10-6(12)14-4-2-8/h1-4H2,(H,9,11)(H,10,12)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
