CAS 89581-50-0

2-Bromobenzenesulfinic acid

Description:

2-Bromobenzenesulfinic acid, with the CAS number 89581-50-0, is an organosulfur compound characterized by the presence of a sulfinic acid functional group (-SO2H) attached to a bromobenzene ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols. The sulfinic acid group imparts acidic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and oxidation processes. 2-Bromobenzenesulfinic acid can serve as a useful intermediate in organic synthesis, particularly in the preparation of sulfonamides and other sulfonic acid derivatives. Its bromine substituent enhances its reactivity, making it a valuable building block in the synthesis of more complex molecules. Additionally, the compound may exhibit specific biological activities, although detailed studies on its biological properties may be limited. Proper handling and storage are essential due to its potential reactivity and the presence of the bromine atom, which can pose health and environmental risks.

Formula: C₆H₅BrO₂S

InChI: InChI=1S/C6H5BrO2S/c7-5-3-1-2-4-6(5)10(8)9/h1-4H,(H,8,9)

InChI key: InChIKey=ZHSKXPDVIUDXON-UHFFFAOYSA-N

SMILES: S(=O)(O)C1=C(Br)C=CC=C1

Synonyms:

• 2-Bromobenzene-1-sulfinic acid
• 2-Bromobenzenesulfinic acid
• Benzenesulfinic acid, 2-bromo-
• 2-Bromo-1-benzenesulfinic acid
• Benzenesulfinic acid, o-bromo-