CAS 89581-80-6
:2-chloro-8-methylsulfanyl-7H-purine
Description:
2-Chloro-8-methylsulfanyl-7H-purine, with the CAS number 89581-80-6, is a purine derivative characterized by the presence of a chlorine atom and a methylsulfanyl group at specific positions on the purine ring. This compound typically exhibits properties common to purines, such as being a heterocyclic aromatic compound with potential biological activity. The chlorine substituent can influence its reactivity and solubility, while the methylsulfanyl group may enhance its lipophilicity and biological interactions. In terms of structure, the purine ring system consists of a fused imidazole and pyrimidine ring, which is essential for its role in various biochemical processes, including nucleic acid metabolism. The compound may be of interest in medicinal chemistry and pharmacology due to its potential as a lead compound for developing therapeutic agents. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic effects of the substituents on the purine core.
Formula:C6H5ClN4S
InChI:InChI=1/C6H5ClN4S/c1-12-6-9-3-2-8-5(7)10-4(3)11-6/h2H,1H3,(H,8,9,10,11)
SMILES:CSc1nc2cnc(Cl)nc2[nH]1
Synonyms:- 7H-purine, 2-chloro-8-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
