CAS 89581-84-0
:pyridine, 2-bromo-3-(chloromethyl)-
Description:
Pyridine, 2-bromo-3-(chloromethyl)-, also known by its CAS number 89581-84-0, is a heterocyclic organic compound that features a pyridine ring substituted with bromine and chloromethyl groups. This compound is characterized by its aromatic nature, which contributes to its stability and reactivity. The presence of the bromine and chloromethyl substituents introduces electrophilic and nucleophilic sites, making it useful in various chemical reactions, including substitution and coupling reactions. Pyridine derivatives are often employed in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to their ability to participate in diverse chemical transformations. Additionally, the compound may exhibit specific physical properties such as solubility in polar solvents and distinct spectral characteristics in techniques like NMR and IR spectroscopy. Safety considerations should be taken into account, as halogenated compounds can pose health risks and environmental concerns. Overall, pyridine, 2-bromo-3-(chloromethyl)- is a valuable compound in organic synthesis and research applications.
Formula:C6H5BrClN
InChI:InChI=1/C6H5BrClN/c7-6-5(4-8)2-1-3-9-6/h1-3H,4H2
SMILES:c1cc(CCl)c(Br)nc1
Synonyms:- 2-Bromo-3-(chloromethyl)pyridine
- 2-Chloro-3-(chloromethyl)pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-chloro-3-(chloromethyl)pyridine
CAS:Formula:C6H5Cl2NPurity:98%Color and Shape:SolidMolecular weight:162.01662-Chloro-3-chloromethyl-pyridine
CAS:2-Chloro-3-chloromethyl-pyridinePurity:98%Color and Shape:SolidMolecular weight:162.02g/mol2-Chloro-3-(chloromethyl)pyridine
CAS:Formula:C6H5Cl2NPurity:98%Color and Shape:SolidMolecular weight:162.012-Chloro-3-chloromethyl-pyridine
CAS:<p>2-Chloro-3-chloromethyl-pyridine is an alkali with a high yield and enantioselectivity. It has been used as an intermediate in the synthesis of pesticides, such as 2,4 dichlorophenoxyacetic acid (2,4 D). The compound is also used to produce sodium hypochlorite in the laboratory. In addition, 2-chloro-3-chloromethyl-pyridine is a useful reagent for the hydrolysis of esters and oxidation of alcohols. This compound can be synthesized using enantioselective reactions or by hydrolyzing an asymmetric precursor.</p>Formula:C6H5Cl2NPurity:Min. 95%Molecular weight:162.02 g/mol



