CAS 89583-92-6

4-Chloropyrido[4,3-d]pyrimidine

Description:

4-Chloropyrido[4,3-d]pyrimidine is a heterocyclic organic compound characterized by a fused ring system that incorporates both pyridine and pyrimidine structures. This compound features a chlorine substituent at the 4-position of the pyridine ring, which can influence its chemical reactivity and biological activity. It typically appears as a crystalline solid and is soluble in organic solvents. The presence of nitrogen atoms in its structure contributes to its potential as a ligand in coordination chemistry and its utility in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various biological activities, making it of interest in drug discovery. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many heterocycles, the electronic properties and steric factors of 4-Chloropyrido[4,3-d]pyrimidine can be tailored for specific applications in research and industry.

Formula: C₇H₄ClN₃

InChI: InChI=1/C7H4ClN3/c8-7-5-3-9-2-1-6(5)10-4-11-7/h1-4H

SMILES: c1cncc2c1ncnc2Cl

Synonyms:

• Pyrido[4,3-D]Pyrimidine, 4-Chloro-

4-Chloropyrido[4,3-d]pyrimidine

CAS: 89583-92-6

Formula: C₇H₄ClN₃

Molecular weight: 165.5798

Ref: IN-DA003XTM

4-Chloropyrido[4,3-d]pyrimidine

CAS: 89583-92-6

4-Chloropyrido[4,3-d]pyrimidine

Purity: ≥95%

Molecular weight: 165.58g/mol

Ref: 54-OR72225