CymitQuimica logo

CAS 89583-98-2

:

Cyclopropanamine, 2-(1-methylethyl)-, hydrochloride (1:1)

Description:
Cyclopropanamine, 2-(1-methylethyl)-, hydrochloride (1:1), with CAS number 89583-98-2, is a chemical compound characterized by its cyclopropane ring structure and an amine functional group. This compound features a branched alkyl group, specifically isopropyl, attached to the nitrogen atom of the amine. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. Cyclopropanamines are known for their unique reactivity due to the strain in the cyclopropane ring, which can influence their chemical behavior and interactions. The presence of the amine group suggests potential applications in medicinal chemistry, as amines are often involved in biological processes and can serve as building blocks for pharmaceuticals. Additionally, the hydrochloride form can facilitate the handling and formulation of the compound in various chemical applications. Overall, this substance exhibits properties typical of both cyclic amines and alkyl-substituted amines, making it of interest in both synthetic and medicinal chemistry contexts.
Formula:C6H13N·ClH
InChI:InChI=1S/C6H13N.ClH/c1-4(2)5-3-6(5)7;/h4-6H,3,7H2,1-2H3;1H
InChI key:InChIKey=IXCRIUWWSSQOBU-UHFFFAOYSA-N
SMILES:C(C)(C)C1C(N)C1.Cl
Synonyms:
  • 2-(Propan-2-yl)cyclopropan-1-amine hydrochloride
  • Cyclopropanamine, 2-(1-methylethyl)-, hydrochloride (1:1)
  • Cyclopropylamine, 2-isopropyl-, hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.