CAS 89585-16-0
:2-(2-Methylpropoxy)ethanamine
Description:
2-(2-Methylpropoxy)ethanamine, with the CAS number 89585-16-0, is an organic compound characterized by its amine functional group and ether linkage. This substance features a two-carbon ethylamine backbone, which is substituted with a 2-methylpropoxy group, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in polar solvents due to the presence of the amine group. The compound may exhibit basic properties typical of amines, allowing it to participate in various chemical reactions, including nucleophilic substitutions and complexation with acids. Its structure suggests potential applications in the synthesis of pharmaceuticals, agrochemicals, or as a surfactant. Safety data indicates that, like many amines, it may be irritating to the skin and eyes, necessitating appropriate handling precautions. Overall, 2-(2-Methylpropoxy)ethanamine is a versatile compound with potential utility in various chemical applications.
Formula:C6H15NO
InChI:InChI=1S/C6H15NO/c1-6(2)5-8-4-3-7/h6H,3-5,7H2,1-2H3
InChI key:InChIKey=ZSLFISNFWCDEIC-UHFFFAOYSA-N
SMILES:C(OCCN)C(C)C
Synonyms:- Ethanamine, 2-(2-methylpropoxy)-
- 2-(2-Methylpropoxy)ethanamine
- Ethylamine, 2-isobutoxy-
- 2-(2-Methylpropoxy)ethan-1-amine
- 2-Isobutoxy-ethylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.