CymitQuimica logo

CAS 895920-80-6

:

N-(3-Acetylphenyl)-5-methyl-3-thiophenecarboxamide

Description:
N-(3-Acetylphenyl)-5-methyl-3-thiophenecarboxamide, with the CAS number 895920-80-6, is a chemical compound characterized by its unique structural features. It contains an acetylphenyl group, which contributes to its aromatic properties, and a thiophene ring, known for its sulfur atom that imparts distinct electronic characteristics. The presence of the carboxamide functional group enhances its potential for hydrogen bonding, influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure suggests potential interactions with various biological targets, which could be explored in medicinal chemistry. Additionally, the presence of both aromatic and heterocyclic components may contribute to its stability and reactivity under different conditions. Overall, N-(3-Acetylphenyl)-5-methyl-3-thiophenecarboxamide represents a versatile compound with potential applications in various fields, including organic synthesis and drug development.
Formula:C14H13NO2S
InChI:InChI=1S/C14H13NO2S/c1-9-6-12(8-18-9)14(17)15-13-5-3-4-11(7-13)10(2)16/h3-8H,1-2H3,(H,15,17)
InChI key:InChIKey=MJSPKCRKZOXYCC-UHFFFAOYSA-N
SMILES:C(NC1=CC(C(C)=O)=CC=C1)(=O)C=2C=C(C)SC2
Synonyms:
  • 3-Thiophenecarboxamide, N-(3-acetylphenyl)-5-methyl-
  • N-(3-Acetylphenyl)-5-methyl-3-thiophenecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.