CAS 895929-38-1

1-[(2-Fluorophenyl)methyl]-1H-pyrazol-3-amine

Description:

1-[(2-Fluorophenyl)methyl]-1H-pyrazol-3-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a 2-fluorophenyl group attached to the pyrazole ring contributes to its unique properties, including potential biological activity. This compound typically exhibits moderate to high solubility in organic solvents, and its structure suggests it may participate in hydrogen bonding due to the amine functional group. The fluorine atom can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its interaction with biological targets. As a result, compounds like this one are often investigated for their pharmacological potential, particularly in the fields of medicinal chemistry and drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 1-[(2-Fluorophenyl)methyl]-1H-pyrazol-3-amine represents a class of compounds that may have significant applications in research and industry.

Formula: C₁₀H₁₀FN₃

InChI: InChI=1S/C10H10FN3/c11-9-4-2-1-3-8(9)7-14-6-5-10(12)13-14/h1-6H,7H2,(H2,12,13)

InChI key: InChIKey=WJLNDRKSXLMBKK-UHFFFAOYSA-N

SMILES: C(C1=C(F)C=CC=C1)N2N=C(N)C=C2

Synonyms:

• 1-[(2-Fluorophenyl)methyl]-1H-pyrazol-3-amine
• 1-[(2-Fluorophenyl)methyl]pyrazol-3-amine
• 1H-Pyrazol-3-amine, 1-[(2-fluorophenyl)methyl]-

1-(2-Fluorobenzyl)-1H-pyrazol-3-amine hydrochloride

CAS: 895929-38-1

1-(2-Fluorobenzyl)-1H-pyrazol-3-amine hydrochloride

Purity: ≥95%

Molecular weight: 227.67g/mol

Ref: 54-PC410001