CAS 895929-92-7
:4-Bromo-1-[(2-chloro-6-fluorophenyl)methyl]-1H-pyrazol-3-amine
Description:
4-Bromo-1-[(2-chloro-6-fluorophenyl)methyl]-1H-pyrazol-3-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a chlorofluorophenyl group at the 1-position contributes to its unique reactivity and potential biological activity. This compound is typically classified as an aromatic amine due to the amino group attached to the pyrazole ring. Its molecular structure suggests it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. The presence of halogen substituents (bromine, chlorine, and fluorine) often enhances lipophilicity and can influence the compound's interaction with biological targets. Additionally, the compound's CAS number, 895929-92-7, allows for easy identification in chemical databases. Overall, 4-Bromo-1-[(2-chloro-6-fluorophenyl)methyl]-1H-pyrazol-3-amine is of interest for its potential applications in drug discovery and development.
Formula:C10H8BrClFN3
InChI:InChI=1S/C10H8BrClFN3/c11-7-5-16(15-10(7)14)4-6-8(12)2-1-3-9(6)13/h1-3,5H,4H2,(H2,14,15)
InChI key:InChIKey=OQZSUQJWJZWEJG-UHFFFAOYSA-N
SMILES:C(C1=C(Cl)C=CC=C1F)N2C=C(Br)C(N)=N2
Synonyms:- 4-Bromo-1-[(2-chloro-6-fluorophenyl)methyl]-1H-pyrazol-3-amine
- 1H-Pyrazol-3-amine, 4-bromo-1-[(2-chloro-6-fluorophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.