CAS 895929-98-3
:4-Bromo-1-[(3,4-dichlorophenyl)methyl]-1H-pyrazol-3-amine
Description:
4-Bromo-1-[(3,4-dichlorophenyl)methyl]-1H-pyrazol-3-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a 3,4-dichlorophenyl group at the 1-position contributes to its unique reactivity and potential biological activity. This compound is typically used in medicinal chemistry and may exhibit properties such as anti-inflammatory or anti-cancer activities, although specific biological effects would depend on further studies. Its molecular structure suggests it may engage in hydrogen bonding and other interactions due to the amine functional group, influencing its solubility and reactivity. The compound's CAS number, 895929-98-3, allows for easy identification in chemical databases and literature. Overall, 4-Bromo-1-[(3,4-dichlorophenyl)methyl]-1H-pyrazol-3-amine is of interest in research for its potential applications in pharmaceuticals and agrochemicals.
Formula:C10H8BrCl2N3
InChI:InChI=1S/C10H8BrCl2N3/c11-7-5-16(15-10(7)14)4-6-1-2-8(12)9(13)3-6/h1-3,5H,4H2,(H2,14,15)
InChI key:InChIKey=TZIYKTURCXASTH-UHFFFAOYSA-N
SMILES:C(N1C=C(Br)C(N)=N1)C2=CC(Cl)=C(Cl)C=C2
Synonyms:- 4-Bromo-1-[(3,4-dichlorophenyl)methyl]-1H-pyrazol-3-amine
- 1H-Pyrazol-3-amine, 4-bromo-1-[(3,4-dichlorophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.