CymitQuimica logo

CAS 895933-27-4

:

N-(4-Acetylphenyl)-4-ethyl-5-methyl-3-thiophenecarboxamide

Description:
N-(4-Acetylphenyl)-4-ethyl-5-methyl-3-thiophenecarboxamide is an organic compound characterized by its complex structure, which includes a thiophene ring and various functional groups. The presence of an acetyl group and an ethyl group contributes to its unique chemical properties, influencing its solubility and reactivity. This compound typically exhibits moderate to high lipophilicity due to the aromatic and aliphatic components, which can affect its biological activity and interaction with other molecules. The thiophene moiety often imparts distinct electronic properties, making it a candidate for applications in pharmaceuticals, agrochemicals, or materials science. Additionally, the amide functional group suggests potential for hydrogen bonding, which can play a significant role in its stability and interactions in biological systems. Overall, the characteristics of this compound make it a subject of interest in various fields, including medicinal chemistry and organic synthesis.
Formula:C16H17NO2S
InChI:InChI=1S/C16H17NO2S/c1-4-14-11(3)20-9-15(14)16(19)17-13-7-5-12(6-8-13)10(2)18/h5-9H,4H2,1-3H3,(H,17,19)
InChI key:InChIKey=SUKWXOCKHYWPTE-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(C(C)=O)C=C1)(=O)C=2C(CC)=C(C)SC2
Synonyms:
  • N-(4-Acetylphenyl)-4-ethyl-5-methyl-3-thiophenecarboxamide
  • 3-Thiophenecarboxamide, N-(4-acetylphenyl)-4-ethyl-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.