CAS 89595-71-1

Chamaejasmenin B

Description:

Chamaejasmenin B is a naturally occurring chemical compound classified as a flavonoid, specifically a type of chalcone. It is derived from various plant sources, particularly those belonging to the genus *Artemisia*. This compound is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. Chamaejasmenin B exhibits a unique structure characterized by a phenolic backbone, which contributes to its reactivity and interaction with biological systems. The compound has garnered interest in pharmacological research due to its potential therapeutic applications, although further studies are necessary to fully elucidate its mechanisms of action and efficacy. Additionally, its presence in traditional herbal medicine highlights its significance in natural product chemistry. As with many flavonoids, Chamaejasmenin B may also play a role in plant defense mechanisms, contributing to the plant's resilience against environmental stressors and pathogens. Overall, this compound represents a fascinating area of study within the field of natural products and their applications in health and medicine.

Formula: C₃₂H₂₆O₁₀

InChI: InChI=1S/C32H26O10/c1-39-19-7-3-15(4-8-19)31-27(29(37)25-21(35)11-17(33)13-23(25)41-31)28-30(38)26-22(36)12-18(34)14-24(26)42-32(28)16-5-9-20(40-2)10-6-16/h3-14,27-28,31-36H,1-2H3/t27-,28-,31-,32-/m1/s1

InChI key: InChIKey=BTCICADMSGBCKA-QWWQXMGCSA-N

SMILES: O=C1[C@]([C@H](OC=2C1=C(O)C=C(O)C2)C3=CC=C(OC)C=C3)([C@]4([C@H](OC=5C(C4=O)=C(O)C=C(O)C5)C6=CC=C(OC)C=C6)[H])[H]

Synonyms:

• (2S,2′S,3S,3′S)-2,2′,3,3′-Tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-methoxyphenyl)[3,3′-bi-4H-1-benzopyran]-4,4′-dione
• [3,3′-Bi-4H-1-benzopyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-methoxyphenyl)-, [2α,3α(2′R*,3′R*)]-(+)-
• [3,3′-Bi-4H-1-benzopyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-methoxyphenyl)-, (2S,2′S,3S,3′S)-
• Chamaejasmenine B
• Chamaejasmenin B

Chamaejasmenin A

CAS: 89595-71-1

Formula: C₃₂H₂₆O₁₀

Purity: 95%

Molecular weight: 570.5428

Ref: IN-DA00H3BL

Chamaejasmenin B

CAS: 89595-71-1

Chamaejasmenin B

Purity: ≥95%

Molecular weight: 570.54g/mol

Ref: 54-BUP00800

Chamaejasmenin B

CAS: 89595-71-1

Chamaejasmenin B, from Stellera chamaejasme L., inhibits cancer growth and metastasis, studied for breast cancer.

Formula: C₃₂H₂₆O₁₀

Purity: 97.65%

Color and Shape: Solid

Molecular weight: 570.54

Ref: TM-TN3628

Chamaejasmenin B

CAS: 89595-71-1

Formula: C₃₂H₂₆O₁₀

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 570.55

Ref: BP-SBP03773