CAS 89598-97-0
:(5-bromo-2-hydroxy-phenyl)boronic acid
Description:
(5-Bromo-2-hydroxy-phenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenolic structure. This compound features a bromine atom at the 5-position and a hydroxyl group at the 2-position of the phenyl ring, which contributes to its reactivity and solubility properties. It is typically a white to off-white solid that is soluble in polar solvents such as water and alcohols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions for the formation of carbon-carbon bonds. The boronic acid moiety allows for the formation of stable complexes with diols, which can be exploited in sensor applications and drug delivery systems. Additionally, the presence of the bromine atom can enhance the electrophilicity of the aromatic ring, facilitating further functionalization. Overall, (5-bromo-2-hydroxy-phenyl)boronic acid is a versatile compound with applications in organic synthesis, medicinal chemistry, and materials science.
Formula:C6H6BBrO3
InChI:InChI=1/C6H6BBrO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9-11H
SMILES:c1cc(c(cc1Br)B(O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Bromo-2-hydroxybenzeneboronic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H6BBrO3Purity:96%Color and Shape:Pale yellow to yellow-brown, SolidMolecular weight:216.83(5-Bromo-2-hydroxyphenyl)boronic acid
CAS:Formula:C6H6BBrO3Purity:97%Color and Shape:SolidMolecular weight:216.82505-Bromo-2-hydroxybenzeneboronic acid
CAS:5-Bromo-2-hydroxybenzeneboronic acidPurity:96%Color and Shape:White SolidMolecular weight:216.83g/mol(5-Bromo-2-hydroxyphenyl)boronic acid
CAS:Formula:C6H6BBrO3Purity:95%Color and Shape:SolidMolecular weight:216.83



