CAS 89599-21-3

5-Pyrimidinesulfonamide, 2-amino-N-ethyl-

Description:

5-Pyrimidinesulfonamide, 2-amino-N-ethyl- is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a sulfonamide functional group, which is characterized by the presence of a sulfonyl group (–SO2–) attached to an amine. The presence of the amino group (–NH2) and the ethyl substituent (–C2H5) on the nitrogen atom contributes to its unique properties. Typically, compounds of this nature exhibit moderate solubility in polar solvents due to the presence of polar functional groups, while their aromatic nature may impart some degree of hydrophobicity. The sulfonamide group is known for its biological activity, often serving as a pharmacophore in medicinal chemistry, particularly in the development of antimicrobial agents. Additionally, the compound may exhibit specific reactivity patterns typical of sulfonamides, such as the ability to form hydrogen bonds and participate in various chemical reactions. Overall, 5-Pyrimidinesulfonamide, 2-amino-N-ethyl- is of interest in both synthetic and medicinal chemistry contexts.

Formula: C₆H₁₀N₄O₂S

InChI: InChI=1S/C6H10N4O2S/c1-2-10-13(11,12)5-3-8-6(7)9-4-5/h3-4,10H,2H2,1H3,(H2,7,8,9)

InChI key: InChIKey=MCTBCTOEQLBYRR-UHFFFAOYSA-N

SMILES: S(NCC)(=O)(=O)C=1C=NC(N)=NC1

Synonyms:

• 2-Amino-pyrimidine-5-sulfonic acid ethylamide
• 2-Amino-N-ethylpyrimidine-5-sulfonamide
• 5-Pyrimidinesulfonamide, 2-amino-N-ethyl-