CAS 896-29-7
:Antimony, dihydroxytriphenyl-, (TB-5-11)-
Description:
Antimony, dihydroxytriphenyl-, commonly referred to by its CAS number 896-29-7, is an organoantimony compound characterized by its unique molecular structure, which includes a triphenyl group and two hydroxyl (-OH) functional groups. This compound typically exhibits properties associated with organometallic substances, such as moderate solubility in organic solvents and potential reactivity due to the presence of the antimony atom, which can exhibit various oxidation states. Antimony compounds are known for their applications in flame retardants, catalysts, and as intermediates in organic synthesis. The dihydroxy groups may impart additional functionalities, such as the ability to form hydrogen bonds, influencing its reactivity and interaction with other chemical species. Safety considerations are important, as antimony and its compounds can be toxic, necessitating careful handling and disposal. Overall, the characteristics of this compound make it of interest in both industrial applications and research contexts, particularly in the fields of materials science and organic chemistry.
Formula:C18H17O2Sb
InChI:InChI=1S/3C6H5.2H2O.Sb/c3*1-2-4-6-5-3-1;;;/h3*1-5H;2*1H2;/q;;;;;+2/p-2
InChI key:InChIKey=HHIOPTIWLTZAEF-UHFFFAOYSA-L
SMILES:[Sb](O)(O)(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- Antimony, dihydroxytriphenyl-
- Triphenylantimony dihydroxide
- Dihydroxytriphenylantimony
- Antimony, dihydroxytriphenyl-, (TB-5-11)-
- Stibine, triphenyl-, dihydroxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
