CAS 89601-11-6
:2,6-Piperazinedicarboxylic acid
Description:
2,6-Piperazinedicarboxylic acid, with the CAS number 89601-11-6, is an organic compound characterized by its piperazine backbone, which features two carboxylic acid groups attached to the 2 and 6 positions of the piperazine ring. This compound is a white to off-white crystalline solid that is soluble in water and polar organic solvents, making it useful in various chemical applications. Its structure allows for the formation of hydrogen bonds, contributing to its solubility and reactivity. 2,6-Piperazinedicarboxylic acid is often utilized in the synthesis of pharmaceuticals, agrochemicals, and as a building block in organic synthesis due to its ability to act as a chelating agent and its potential to form various derivatives. Additionally, it may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken during use.
Formula:C6H10N2O4
InChI:InChI=1S/C6H10N2O4/c9-5(10)3-1-7-2-4(8-3)6(11)12/h3-4,7-8H,1-2H2,(H,9,10)(H,11,12)
InChI key:InChIKey=AHWWYXLUWXDFLF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1NC(C(O)=O)CNC1
Synonyms:- 2,6-Piperazinedicarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
