CAS 89603-18-9

2-Methyl-2,3-oxiranedicarboxylic acid

Description:

2-Methyl-2,3-oxiranedicarboxylic acid, also known as methylenesuccinic acid, is a chemical compound characterized by its unique structure that includes an epoxide group and two carboxylic acid functional groups. This compound is typically a colorless to pale yellow liquid or solid, depending on its state and purity. It is soluble in water and organic solvents, making it versatile for various applications. The presence of the epoxide group contributes to its reactivity, allowing it to participate in ring-opening reactions and polymerization processes. The carboxylic acid groups provide acidity and the potential for forming salts and esters. This compound is of interest in organic synthesis and may be used in the production of polymers, resins, and other chemical intermediates. Safety considerations include handling it with care due to its potential irritant properties. Overall, 2-Methyl-2,3-oxiranedicarboxylic acid is a valuable compound in both research and industrial applications.

Formula: C₅H₆O₅

InChI: InChI=1S/C5H6O5/c1-5(4(8)9)2(10-5)3(6)7/h2H,1H3,(H,6,7)(H,8,9)

InChI key: InChIKey=CGWLDGFBAMHEMO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(C)C(C(O)=O)O1

Synonyms:

• Succinic acid, epoxymethyl-
• 2-Methyl-2,3-oxiranedicarboxylic acid
• 2,3-Oxiranedicarboxylic acid, 2-methyl-

2,3-Oxiranedicarboxylicacid, 2-methyl-

CAS: 89603-18-9

Formula: C₅H₆O₅

Molecular weight: 146.0981

Ref: IN-DA003XJ6