CymitQuimica logo

CAS 896047-15-7

:

1-[(3-Methylphenyl)methyl]-3-piperidinecarboxylic acid

Description:
1-[(3-Methylphenyl)methyl]-3-piperidinecarboxylic acid, identified by its CAS number 896047-15-7, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a 3-methylphenyl group that enhances its hydrophobic characteristics. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored in medicinal chemistry for their pharmacological properties. The compound's structure indicates it may exhibit interactions with biological targets, making it of interest in drug development. Additionally, the presence of both hydrophilic (carboxylic acid) and hydrophobic (aromatic ring) components may influence its solubility and permeability, which are critical factors in pharmacokinetics. Overall, this compound's unique structural features position it as a candidate for further research in various chemical and pharmaceutical applications.
Formula:C14H19NO2
InChI:InChI=1S/C14H19NO2/c1-11-4-2-5-12(8-11)9-15-7-3-6-13(10-15)14(16)17/h2,4-5,8,13H,3,6-7,9-10H2,1H3,(H,16,17)
InChI key:InChIKey=JANXWXFEKJLETQ-UHFFFAOYSA-N
SMILES:C(N1CC(C(O)=O)CCC1)C2=CC(C)=CC=C2
Synonyms:
  • 3-Piperidinecarboxylic acid, 1-[(3-methylphenyl)methyl]-
  • 1-[(3-Methylphenyl)methyl]-3-piperidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.