CAS 89605-12-9
:2-Propen-1-yl 4-chloro-3-oxobutanoate
Description:
2-Propen-1-yl 4-chloro-3-oxobutanoate, also known by its CAS number 89605-12-9, is an organic compound characterized by its ester functional group and a conjugated system due to the presence of a propenyl group. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents. Its structure features a chloro substituent, which can influence its reactivity and stability, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and polymerization processes. The presence of the oxobutanoate moiety suggests that it may participate in reactions typical of α,β-unsaturated carbonyl compounds, such as Michael additions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Safety data should be consulted, as halogenated compounds can pose health risks. Overall, 2-Propen-1-yl 4-chloro-3-oxobutanoate is a versatile compound with potential applications in organic synthesis and materials science.
Formula:C7H9ClO3
InChI:InChI=1S/C7H9ClO3/c1-2-3-11-7(10)4-6(9)5-8/h2H,1,3-5H2
InChI key:InChIKey=RKKOBITWQBBTDH-UHFFFAOYSA-N
SMILES:C(CC(CCl)=O)(OCC=C)=O
Synonyms:- Allyl γ-chloroacetoacetate
- Butanoic acid, 4-chloro-3-oxo-, 2-propen-1-yl ester
- Butanoic acid, 4-chloro-3-oxo-, 2-propenyl ester
- 4-Chloroacetoacetic acid allyl ester
- 2-Propen-1-yl 4-chloro-3-oxobutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
