CymitQuimica logo

CAS 89607-11-4

:

1H-Pyrazole, 4-bromo-1-methyl-5-nitro-

Description:
1H-Pyrazole, 4-bromo-1-methyl-5-nitro- is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position, a methyl group at the 1-position, and a nitro group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is soluble in organic solvents but may have limited solubility in water. The nitro group is known for its electron-withdrawing properties, which can influence the reactivity of the compound in various chemical reactions, such as nucleophilic substitutions or reductions. Additionally, the bromine atom can serve as a site for further functionalization, making this compound of interest in synthetic organic chemistry and medicinal chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks due to its chemical nature.
Formula:C4H4BrN3O2
InChI:InChI=1S/C4H4BrN3O2/c1-7-4(8(9)10)3(5)2-6-7/h2H,1H3
InChI key:VRXGHSCAAADKCM-UHFFFAOYSA-N
SMILES:CN1C(=C(C=N1)Br)[N+](=O)[O-]
Synonyms:
  • 1H-Pyrazole, 4-broMo-1-Methyl-5-nitro-
  • 4-bromo-1-methyl-5-nitropyrazole
  • 4-Bromo-1-ethyl-5-nitro-pyrazole
Found 4 products.