CymitQuimica logo

CAS 89607-14-7

:

1H-Pyrazole, 3,4-dibromo-1-methyl-

Description:
1H-Pyrazole, 3,4-dibromo-1-methyl- is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two nitrogen atoms. The presence of bromine substituents at the 3 and 4 positions of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. The methyl group at the 1 position enhances its solubility in organic solvents and may influence its biological activity. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential as a building block for more complex molecules. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety data should be consulted to handle this compound appropriately, as halogenated compounds can exhibit toxicity and environmental concerns. Overall, 1H-Pyrazole, 3,4-dibromo-1-methyl- is a versatile compound with significant implications in synthetic chemistry.
Formula:C4H4Br2N2
InChI:InChI=1S/C4H4Br2N2/c1-8-2-3(5)4(6)7-8/h2H,1H3
InChI key:DIFVKLRTMZFVBS-UHFFFAOYSA-N
SMILES:CN1C=C(C(=N1)Br)Br
Found 5 products.