
CAS 89607-16-9
:1-Methyl-5-nitro-1H-pyrazol-4-amine
Description:
1-Methyl-5-nitro-1H-pyrazol-4-amine, with the CAS number 89607-16-9, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group at the 1-position and a nitro group at the 5-position, along with an amino group at the 4-position of the pyrazole ring. These functional groups contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the nitro group typically imparts significant polarity and can influence the compound's solubility in different solvents. Additionally, the amino group can participate in hydrogen bonding, affecting the compound's interactions with biological systems. 1-Methyl-5-nitro-1H-pyrazol-4-amine may exhibit biological activity, making it of interest for research in medicinal chemistry. However, as with many nitro compounds, it is essential to handle it with care due to potential toxicity and environmental considerations.
Formula:C4H6N4O2
InChI:InChI=1S/C4H6N4O2/c1-7-4(8(9)10)3(5)2-6-7/h2H,5H2,1H3
InChI key:InChIKey=DZHKSYCPRIBWJJ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N)C=NN1C
Synonyms:- 1H-Pyrazol-4-amine, 1-methyl-5-nitro-
- 1-Methyl-5-nitro-1H-pyrazol-4-amine
- 4-Amino-1-methyl-5-nitropyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
