CymitQuimica logo

CAS 89607-43-2

:

6-Amino-1,4-dihydro-4-(4-hydroxyphenyl)-3-methylpyrano[2,3-c]pyrazole-5-carbonitrile

Description:
6-Amino-1,4-dihydro-4-(4-hydroxyphenyl)-3-methylpyrano[2,3-c]pyrazole-5-carbonitrile, with the CAS number 89607-43-2, is a chemical compound that features a complex structure incorporating a pyrano-pyrazole framework. This compound is characterized by the presence of an amino group, a carbonitrile group, and a hydroxyphenyl substituent, which contribute to its potential biological activity. The pyrano and pyrazole rings provide a unique heterocyclic system that may exhibit interesting pharmacological properties. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly as anti-inflammatory or anticancer agents. The presence of multiple functional groups allows for diverse interactions with biological targets, making it a subject of interest in drug development. Additionally, its solubility and stability in various solvents can influence its bioavailability and efficacy. Overall, this compound exemplifies the complexity and potential of heterocyclic chemistry in the search for new therapeutic agents.
Formula:C14H12N4O2
InChI:InChI=1S/C14H12N4O2/c1-7-11-12(8-2-4-9(19)5-3-8)10(6-15)13(16)20-14(11)18-17-7/h2-5,12,19H,16H2,1H3,(H,17,18)
InChI key:InChIKey=HMUNAHGDBDCYKK-UHFFFAOYSA-N
SMILES:C(#N)C=1C(C2=C(OC1N)NN=C2C)C3=CC=C(O)C=C3
Synonyms:
  • Pyrano[2,3-c]pyrazole-5-carbonitrile, 6-amino-1,4-dihydro-4-(4-hydroxyphenyl)-3-methyl-
  • 6-Amino-1,4-dihydro-4-(4-hydroxyphenyl)-3-methylpyrano[2,3-c]pyrazole-5-carbonitrile
  • 6-Amino-4-(4-hydroxyphenyl)-3-methyl-1,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.