CymitQuimica logo

CAS 896114-82-2

:

6-Nitro-2-phenyl-3H-imidazo[4,5-b]pyridine

Description:
6-Nitro-2-phenyl-3H-imidazo[4,5-b]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a nitro group at the 6-position and a phenyl group at the 2-position enhances its reactivity and potential biological activity. This compound typically exhibits moderate to high solubility in organic solvents, while its solubility in water may be limited due to its hydrophobic phenyl group. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound's structure allows for various substitution patterns, which can influence its pharmacological properties. Additionally, it may exhibit fluorescence, making it useful in certain analytical applications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H8N4O2
InChI:InChI=1S/C12H8N4O2/c17-16(18)9-6-10-12(13-7-9)15-11(14-10)8-4-2-1-3-5-8/h1-7H,(H,13,14,15)
InChI key:InChIKey=WVRSXPFJEQAQKU-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C2C(N=C(N2)C3=CC=CC=C3)=NC1
Synonyms:
  • 6-Nitro-2-phenyl-3H-imidazo[4,5-b]pyridine
  • 1H-Imidazo[4,5-b]pyridine, 6-nitro-2-phenyl-
  • 3H-Imidazo[4,5-b]pyridine, 6-nitro-2-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.