CAS 896139-85-8

imidazo[1,2-a]pyridin-7-ol

Description:

Imidazo[1,2-a]pyridin-7-ol is a heterocyclic compound characterized by its fused imidazole and pyridine rings, with a hydroxyl group (-OH) located at the 7-position of the pyridine ring. This compound exhibits a range of interesting chemical properties due to the presence of both nitrogen atoms in the imidazole and pyridine moieties, which can participate in hydrogen bonding and coordination with metal ions. The hydroxyl group contributes to its potential as a weak acid and can influence its solubility and reactivity. Imidazo[1,2-a]pyridin-7-ol is of interest in medicinal chemistry for its potential biological activities, including antimicrobial and anticancer properties. Its structural features allow for various modifications, making it a versatile scaffold for drug development. Additionally, the compound may exhibit fluorescence, which can be useful in biological imaging applications. Overall, imidazo[1,2-a]pyridin-7-ol represents a significant class of compounds with diverse applications in pharmaceuticals and materials science.

Formula: C₇H₆N₂O

InChI: InChI=1/C7H6N2O/c10-6-1-3-9-4-2-8-7(9)5-6/h1-5,10H

SMILES: c1cn2ccnc2cc1O

imidazo[1,2-a]pyridin-7-ol

CAS: 896139-85-8

Formula: C₇H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 134.1353

Ref: IN-DA003XDK

Imidazo[1,2-a]pyridin-7-ol

CAS: 896139-85-8

Imidazo[1,2-a]pyridin-7-ol

Formula: C₇H₆N₂O

Purity: 97%

Color and Shape: yellow-brown solid

Molecular weight: 134.14g/mol

Ref: 54-OR305451

Imidazo[1,2-a]pyridin-7-ol

CAS: 896139-85-8

Formula: C₇H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 134.138

Ref: 10-F230319

Imidazo[1,2-a]pyridin-7-ol

Controlled Product

CAS: 896139-85-8

Applications Intermediate for heterocyclic compounds as tyrosine kinase inhibitors and anticancer agents.
References McLean, A., et al.: J. Chem. Phys., 72, 5639 (1980), Watts, J., et al.: J. Biol. Chem., 276, 43197 (2001),

Formula: C₇H₆N₂O

Color and Shape: Neat

Molecular weight: 134.14

Ref: TR-I387500